![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
45th Street | 20-Apr-2018 16:20 | - | |
|
Abeyance | 20-Apr-2018 16:20 | - | |
|
Adultnapper vs. Dan Berkson | 20-Apr-2018 16:20 | - | |
|
Afrika Bambaataa feat. Carpe Diem | 20-Apr-2018 16:20 | - | |
|
Ale Möller Band | 20-Apr-2018 16:20 | - | |
|
Aleksander Rjabov ja ansambel Synthesis | 20-Apr-2018 16:20 | - | |
|
Alex Coollook & Aris Grammenos | 20-Apr-2018 16:20 | - | |
|
Alibi | 20-Apr-2018 16:20 | - | |
|
Alison Krauss & Alan Jackson | 20-Apr-2018 16:20 | - | |
|
Almost There | 20-Apr-2018 16:20 | - | |
|
Alta tensió | 20-Apr-2018 16:20 | - | |
|
Antlers | 20-Apr-2018 16:20 | - | |
|
Anything Goes | 20-Apr-2018 16:20 | - | |
|
Aramirè | 20-Apr-2018 16:20 | - | |
|
Arik Sinai | 20-Apr-2018 16:20 | - | |
|
Astaarth | 20-Apr-2018 16:20 | - | |
|
Astyplaz | 20-Apr-2018 16:20 | - | |
|
Axel Bartsch & Asem Shama | 20-Apr-2018 16:20 | - | |
|
Bare Knees | 20-Apr-2018 16:20 | - | |
|
Baronets | 20-Apr-2018 16:20 | - | |
|
Bartel | 20-Apr-2018 16:20 | - | |
|
Bel's Boys | 20-Apr-2018 16:20 | - | |
|
Bet bet un Jāzepa Mediņa mūzikas skolas zēnu koris | 20-Apr-2018 16:20 | - | |
|
Bette Davis | 20-Apr-2018 16:20 | - | |
|
Bill Mays & Ed Bickert | 20-Apr-2018 16:20 | - | |
|
Birr + Mareck | 20-Apr-2018 16:20 | - | |
|
Blackguard | 20-Apr-2018 16:20 | - | |
|
Blame It on Edd | 20-Apr-2018 16:20 | - | |
|
Blue Grass Boogiemen | 20-Apr-2018 16:20 | - | |
|
Bondi Cigars | 20-Apr-2018 16:20 | - | |
|
Brian Stone | 20-Apr-2018 16:20 | - | |
|
Bright Young Lights | 20-Apr-2018 16:20 | - | |
|
Brom | 20-Apr-2018 16:20 | - | |
|
Brooklyn Dreams | 20-Apr-2018 16:20 | - | |
|
Buddy Judge | 20-Apr-2018 16:20 | - | |
|
Calder | 20-Apr-2018 16:20 | - | |
|
Cape Breton Barbarians | 20-Apr-2018 16:20 | - | |
|
Cecil Sharp Project | 20-Apr-2018 16:20 | - | |
|
Cenon Lagman | 20-Apr-2018 16:20 | - | |
|
Champagne Riot | 20-Apr-2018 16:20 | - | |
|
Clash | 20-Apr-2018 16:20 | - | |
|
Clausel vs. Bam Lee | 20-Apr-2018 16:20 | - | |
|
Coleco Music | 20-Apr-2018 16:20 | - | |
|
Control | 20-Apr-2018 16:20 | - | |
|
Copper Kettle | 20-Apr-2018 16:20 | - | |
|
Cowboys & Monsters | 20-Apr-2018 16:20 | - | |
|
Crea | 20-Apr-2018 16:20 | - | |
|
Criadero En Seres | 20-Apr-2018 16:20 | - | |
|
Crown the Lost | 20-Apr-2018 16:20 | - | |
|
Cry of a Generation Ministries | 20-Apr-2018 16:20 | - | |
|
Cylab | 20-Apr-2018 16:20 | - | |
|
DJ Aleksij | 20-Apr-2018 16:20 | - | |
|
DJ Apollo | 20-Apr-2018 16:20 | - | |
|
Daemonheim | 20-Apr-2018 16:20 | - | |
|
Danny Darst | 20-Apr-2018 16:20 | - | |
|
Danny Dodge | 20-Apr-2018 16:20 | - | |
|
Danny Lips | 20-Apr-2018 16:20 | - | |
|
Dash Dude | 20-Apr-2018 16:20 | - | |
|
David Arkenstone, Kostia and David Lanz | 20-Apr-2018 16:20 | - | |
|
Dawson Wells | 20-Apr-2018 16:20 | - | |
|
Delgui | 20-Apr-2018 16:20 | - | |
|
Denitia Odigie | 20-Apr-2018 16:20 | - | |
|
Denver Harbor | 20-Apr-2018 16:20 | - | |
|
Devar-Toi | 20-Apr-2018 16:20 | - | |
|
Dodenstorm | 20-Apr-2018 16:20 | - | |
|
Dr. Shri Balaji Tambe | 20-Apr-2018 16:20 | - | |
|
Dutch Space Mission | 20-Apr-2018 16:20 | - | |
|
Dvyniai | 20-Apr-2018 16:20 | - | |
|
EKYU | 20-Apr-2018 16:20 | - | |
|
El Diablo en el Ojo | 20-Apr-2018 16:20 | - | |
|
Equations of Eternity | 20-Apr-2018 16:20 | - | |
|
Eriko with Crunch | 20-Apr-2018 16:20 | - | |
|
Eternal Deformity | 20-Apr-2018 16:20 | - | |
|
Ethereal Scourge | 20-Apr-2018 16:20 | - | |
|
Eyesinside | 20-Apr-2018 16:20 | - | |
|
Few and Far Between | 20-Apr-2018 16:20 | - | |
|
Florenz Ziegfeld | 20-Apr-2018 16:20 | - | |
|
Fortitude | 20-Apr-2018 16:20 | - | |
|
Frank Müller aka. Beroshima | 20-Apr-2018 16:20 | - | |
|
Freakulizer | 20-Apr-2018 16:20 | - | |
|
Freedoom | 20-Apr-2018 16:20 | - | |
|
Fritz Brause | 20-Apr-2018 16:20 | - | |
|
From Tomorrow | 20-Apr-2018 16:20 | - | |
|
Gael Warning | 20-Apr-2018 16:20 | - | |
|
Geraint Hughes | 20-Apr-2018 16:20 | - | |
|
Go Van Gogh | 20-Apr-2018 16:20 | - | |
|
Gordon Lorenz | 20-Apr-2018 16:20 | - | |
|
Grup Mp3 | 20-Apr-2018 16:20 | - | |
|
Guru feat. MC Solaar | 20-Apr-2018 16:20 | - | |
|
Hachazo | 20-Apr-2018 16:20 | - | |
|
Hank Jones, Wendell Marshall & Kenny Clarke | 20-Apr-2018 16:20 | - | |
|
Hannibal Marvin Peterson ⁄ The Sunrise Orchestra | 20-Apr-2018 16:20 | - | |
|
Happy House | 20-Apr-2018 16:20 | - | |
|
Herbst | 20-Apr-2018 16:20 | - | |
|
Hüüsmüsig Gehrig | 20-Apr-2018 16:20 | - | |
|
Hương Thanh | 20-Apr-2018 16:20 | - | |
|
I Against I | 20-Apr-2018 16:20 | - | |
|
INK | 20-Apr-2018 16:20 | - | |
|
Iben | 20-Apr-2018 16:20 | - | |
|
Ill.Skillz & S.P.Y | 20-Apr-2018 16:20 | - | |
|
In Whispers | 20-Apr-2018 16:20 | - | |
|
Incomplete | 20-Apr-2018 16:20 | - | |
|
Inezita Barroso | 20-Apr-2018 16:20 | - | |
|
Ithaca | 20-Apr-2018 16:20 | - | |
|
Jocelyn McNeil | 20-Apr-2018 16:20 | - | |
|
Joe & Eddie | 20-Apr-2018 16:20 | - | |
|
Joshua Sitron | 20-Apr-2018 16:20 | - | |
|
Julie Plug | 20-Apr-2018 16:20 | - | |
|
Kaja | 20-Apr-2018 16:20 | - | |
|
Kelli Scarr | 20-Apr-2018 16:20 | - | |
|
Kiddy Grade | 20-Apr-2018 16:20 | - | |
|
Kingdom Kids Worship Team | 20-Apr-2018 16:20 | - | |
|
Kinovia | 20-Apr-2018 16:20 | - | |
|
Knucklepuck | 20-Apr-2018 16:20 | - | |
|
Kopfkracher | 20-Apr-2018 16:20 | - | |
|
LDFD | 20-Apr-2018 16:20 | - | |
|
La FouRmiLièRe | 20-Apr-2018 16:20 | - | |
|
La Vallée | 20-Apr-2018 16:20 | - | |
|
Laura Doyle | 20-Apr-2018 16:20 | - | |
|
Laurence O'Keefe | 20-Apr-2018 16:20 | - | |
|
Lee Anderson | 20-Apr-2018 16:20 | - | |
|
Lee Rocker | 20-Apr-2018 16:20 | - | |
|
Legend Maker | 20-Apr-2018 16:20 | - | |
|
Lorindo | 20-Apr-2018 16:20 | - | |
|
Los Pacaminos | 20-Apr-2018 16:20 | - | |
|
Los Voltage | 20-Apr-2018 16:20 | - | |
|
Louie Fontaine | 20-Apr-2018 16:20 | - | |
|
Lynx & Maple | 20-Apr-2018 16:20 | - | |
|
Létající rabín | 20-Apr-2018 16:20 | - | |
|
Magnolia Acoustic Quartet | 20-Apr-2018 16:20 | - | |
|
Maids of Salem | 20-Apr-2018 16:20 | - | |
|
Majoy | 20-Apr-2018 16:20 | - | |
|
Malum Persicum | 20-Apr-2018 16:20 | - | |
|
Manray | 20-Apr-2018 16:20 | - | |
|
Many Machines on Nine | 20-Apr-2018 16:20 | - | |
|
Marc Streitenfeld, Mike Patton & Serj Tankian | 20-Apr-2018 16:20 | - | |
|
Marcello Napoletano | 20-Apr-2018 16:20 | - | |
|
Margaret Davis | 20-Apr-2018 16:20 | - | |
|
Margaret Whiting with Frank DeVol and His Orchestra | 20-Apr-2018 16:20 | - | |
|
Mariano Barba | 20-Apr-2018 16:20 | - | |
|
Marshall Family | 20-Apr-2018 16:20 | - | |
|
Melinda Wrede | 20-Apr-2018 16:20 | - | |
|
Mestre Elias | 20-Apr-2018 16:20 | - | |
|
Meterman | 20-Apr-2018 16:20 | - | |
|
Michal Novinski | 20-Apr-2018 16:20 | - | |
|
Mikus Frišfelds | 20-Apr-2018 16:20 | - | |
|
Mixx Vibes | 20-Apr-2018 16:20 | - | |
|
Moda Modè | 20-Apr-2018 16:20 | - | |
|
Mors in Tabula | 20-Apr-2018 16:20 | - | |
|
Móre & Virumaa Poistekoor | 20-Apr-2018 16:20 | - | |
|
Napoleon Skullfukk | 20-Apr-2018 16:20 | - | |
|
Neverending Story | 20-Apr-2018 16:20 | - | |
|
New Wave Hookers | 20-Apr-2018 16:20 | - | |
|
Nightshade Kiss | 20-Apr-2018 16:20 | - | |
|
Nostalgia | 20-Apr-2018 16:20 | - | |
|
Nulla Iperreale | 20-Apr-2018 16:20 | - | |
|
Oblivion Ensemble | 20-Apr-2018 16:20 | - | |
|
Ocuban | 20-Apr-2018 16:20 | - | |
|
Oddsodz | 20-Apr-2018 16:20 | - | |
|
Oedo Wind Orchestra | 20-Apr-2018 16:20 | - | |
|
One Point Two | 20-Apr-2018 16:20 | - | |
|
Out of Mind | 20-Apr-2018 16:20 | - | |
|
Passage & The Bomarr Monk | 20-Apr-2018 16:20 | - | |
|
Paul Ponnudorai | 20-Apr-2018 16:20 | - | |
|
Peach Weber | 20-Apr-2018 16:20 | - | |
|
Peter Duimelinks, Roel Meelkop & Ralf Wehowsky | 20-Apr-2018 16:20 | - | |
|
Peter Wolf Crier | 20-Apr-2018 16:20 | - | |
|
Plasma Alliance | 20-Apr-2018 16:20 | - | |
|
Player Two | 20-Apr-2018 16:20 | - | |
|
Plonk | 20-Apr-2018 16:20 | - | |
|
Primax | 20-Apr-2018 16:20 | - | |
|
Primordial Undermind | 20-Apr-2018 16:20 | - | |
|
Priya Thomas | 20-Apr-2018 16:20 | - | |
|
Prosessor Balthazar | 20-Apr-2018 16:20 | - | |
|
Pure Morning | 20-Apr-2018 16:20 | - | |
|
Purina Kitten Chow | 20-Apr-2018 16:20 | - | |
|
REDЯUM | 20-Apr-2018 16:20 | - | |
|
Ragtag & Bobtails | 20-Apr-2018 16:20 | - | |
|
Regatt | 20-Apr-2018 16:20 | - | |
|
Regnum Aeterna | 20-Apr-2018 16:20 | - | |
|
Reinforced | 20-Apr-2018 16:20 | - | |
|
Restful | 20-Apr-2018 16:20 | - | |
|
Reykjavík Wind Quintet | 20-Apr-2018 16:20 | - | |
|
Rich T | 20-Apr-2018 16:20 | - | |
|
Rudresh Mahanthappa & Bunky Green | 20-Apr-2018 16:20 | - | |
|
Runtime Pilot | 20-Apr-2018 16:20 | - | |
|
S.A.S. | 20-Apr-2018 16:20 | - | |
|
SKW | 20-Apr-2018 16:20 | - | |
|
Safari Sound Band | 20-Apr-2018 16:20 | - | |
|
Schanzenbach | 20-Apr-2018 16:20 | - | |
|
Schnittstelle | 20-Apr-2018 16:20 | - | |
|
Schéol | 20-Apr-2018 16:20 | - | |
|
Scott Williamson | 20-Apr-2018 16:20 | - | |
|
Seiinerzeit | 20-Apr-2018 16:20 | - | |
|
Sherpa | 20-Apr-2018 16:20 | - | |
|
Shoot to Kill | 20-Apr-2018 16:20 | - | |
|
Showtime | 20-Apr-2018 16:20 | - | |
|
Shujaat Hussain Khan | 20-Apr-2018 16:20 | - | |
|
Shyra Panzardo | 20-Apr-2018 16:20 | - | |
|
Skandaali | 20-Apr-2018 16:20 | - | |
|
Sonority Subunit | 20-Apr-2018 16:20 | - | |
|
Spirituals | 20-Apr-2018 16:20 | - | |
|
Spymaster & Eric Nouhan | 20-Apr-2018 16:20 | - | |
|
Stone Disciple | 20-Apr-2018 16:20 | - | |
|
TKY | 20-Apr-2018 16:20 | - | |
|
Talamasca | 20-Apr-2018 16:20 | - | |
|
Team Age | 20-Apr-2018 16:20 | - | |
|
Tear of a Doll | 20-Apr-2018 16:20 | - | |
|
The Blassics | 20-Apr-2018 16:20 | - | |
|
The Caligaris | 20-Apr-2018 16:20 | - | |
|
The Divine Madness | 20-Apr-2018 16:20 | - | |
|
The Girls | 20-Apr-2018 16:20 | - | |
|
The Good Samaritans | 20-Apr-2018 16:20 | - | |
|
The Gunpowder Treason | 20-Apr-2018 16:20 | - | |
|
The Highway Beautiful | 20-Apr-2018 16:20 | - | |
|
The Main Offender | 20-Apr-2018 16:20 | - | |
|
The Man's Machine | 20-Apr-2018 16:20 | - | |
|
The Ripple Effect | 20-Apr-2018 16:20 | - | |
|
The Saint James Harp Quartet | 20-Apr-2018 16:20 | - | |
|
The Smashchords | 20-Apr-2018 16:20 | - | |
|
The Surs | 20-Apr-2018 16:20 | - | |
|
Thefft | 20-Apr-2018 16:20 | - | |
|
Tim Weed | 20-Apr-2018 16:20 | - | |
|
Timati & P. Diddy, DJ Antoine, Dirty Money | 20-Apr-2018 16:20 | - | |
|
Transonic | 20-Apr-2018 16:20 | - | |
|
Ultrablue | 20-Apr-2018 16:20 | - | |
|
Urethral Defecation | 20-Apr-2018 16:20 | - | |
|
Verdure | 20-Apr-2018 16:20 | - | |
|
Vincent Minor | 20-Apr-2018 16:20 | - | |
|
Virkavalta | 20-Apr-2018 16:20 | - | |
|
Vlatko Stefanovski & Bodan Arsovski | 20-Apr-2018 16:20 | - | |
|
Wart | 20-Apr-2018 16:20 | - | |
|
Watios | 20-Apr-2018 16:20 | - | |
|
We Keep The City Running | 20-Apr-2018 16:20 | - | |
|
Whatchamacallit | 20-Apr-2018 16:20 | - | |
|
White Circle Crime Club | 20-Apr-2018 16:20 | - | |
|
William S. Burroughs + Gus Van Sant | 20-Apr-2018 16:20 | - | |
|
Winds of Sorrow | 20-Apr-2018 16:20 | - | |
|
Wonder Workshop | 20-Apr-2018 16:20 | - | |
|
Woody Herman with Orchestral Acc. | 20-Apr-2018 16:20 | - | |
|
Zespół Instrumentalny Orkiestry Reprezentacyjnej Śląskiego Okręgu Wojskowego | 20-Apr-2018 16:20 | - | |
|
Zulihs | 20-Apr-2018 16:20 | - | |
|
Zé Pipa Dos 8 Baixos | 20-Apr-2018 16:20 | - | |
|
kaïros | 20-Apr-2018 16:20 | - | |
|
manosx | 20-Apr-2018 16:20 | - | |
|
vrouw met rottige monotoonstem | 20-Apr-2018 16:20 | - | |
|
Кола Бельды | 20-Apr-2018 16:20 | - | |
|
いしだあゆみ | 20-Apr-2018 16:20 | - | |
|
张克帆 | 20-Apr-2018 16:20 | - | |
|
査～マルサ～ | 20-Apr-2018 16:20 | - | |